| Identification | |
| Name: | 4-Bromobenzyl bromide |
| Synonyms: | alpha,4-Dibromotoluene; Bromobenzylbromide,95%; 4-Bromobenzylbromide; alpha p-Dibromotoluene |
| CAS: | 589-15-1 |
| EINECS: | 209-636-5 |
| Molecular Formula: | C7H6Br2 |
| Molecular Weight: | 249.93 |
| InChI: | InChI=1/C7H6Br2/c8-5-6-1-3-7(9)4-2-6/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8 |
| Density: | 1.849 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | MAY DECOMPOSE |
| Solubility: | MAY DECOMPOSE with water |
| Appearance: | White solid |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Store at R.T. |
| Sensitive: | Lachrymatory |
| Usage: | Identification of aromatic carboxylic acids. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
