| Identification | |
| Name: | 2-Fluoro-4-bromobenzyl bromide |
| Synonyms: | 4-Bromo-2-fluorobenzyl bromide; 2-Fluoro-bromobenzyl bromide |
| CAS: | 76283-09-5 |
| EINECS: | 278-412-7 |
| Molecular Formula: | C7H5Br2F |
| Molecular Weight: | 267.92 |
| InChI: | InChI=1/C7H5Br2F/c8-4-5-1-2-6(9)3-7(5)10/h1-3H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2923 |
| Density: | 1.923 g/cm3 |
| Stability: | Stable under normal shipping and handling conditions. |
| Refractive index: | 1.583 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?4-Bromo-2-fluorobenzyl bromide (CAS NO.76283-09-5) is also named as 4,alpha-Dibromo-2-fluorotoluene?; 4-Brom-1-(brommethyl)-2-fluorbenzol [German] ; 4-Bromo-1-(bromomethyl)-2-fluorobenzene ; Benzene, 4-bromo-1-(bromomethyl)-2-fluoro- ; 2-Fluoro-4-bromo-benzylbromide .?4-Bromo-2-fluorobenzyl bromide (CAS NO.76283-09-5) is white to light yellow crystal powder. |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. Corrosives area. |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
