| Identification | |
| Name: | 4-Chloro-3-methylphenol |
| Synonyms: | 6-Chloro-3-hydroxytoluene; 2-Chloro-5-hydroxytoluene; 3-Methyl-4-chlorophenol; p-Chloro-m-cresol; 4-Chloro-m-cresol; 4-Chloro-m-cresol; PCMC; 4-Chloro-m-cresol (OH=1); 4-Chloro-m-cresol 98+ %; 4-Chloro-l,3-Methylphenol |
| CAS: | 59-50-7 |
| EINECS: | 200-431-6 |
| Molecular Formula: | C7H7ClO |
| Molecular Weight: | 142.58 |
| InChI: | InChI=1/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2669/3077 |
| Density: | 1.37 |
| Stability: | Stable. Incompatible with brass, oxidizing agents, copper, copper alloys. |
| Refractive index: | 1.5403 (73 C) |
| Solubility: | 4 g/L (20 oC) |
| Appearance: | Off white crystals |
| Report: |
Reported in EPA TSCA Inventory. Chlorophenol compounds are on the Community Right-To-Know List. |
| Packinggroup: | II |
| HS Code: | 29081000 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Color: | Dimorphous crystals Crystals from petroleum ether WHITE OR SLIGHTLY PINK CRYSTALS |
| Usage: | External germicides, preservative for glues, gums, paints, inks, textile & leather goods. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
