| Identification | ||
| Name: | 4-Chloro-2-methylphenol | |
| Synonyms: | Chlorocresol; 90%; 5-Chloro-2-hydroxytoluene; 4-Chloro-o-cresol (OH=1); 4-Chloro-o-cresol | |
| CAS: | 1570-64-5 | |
| EINECS: | 216-381-3 | |
| Molecular Formula: | C7H7ClO | |
| Molecular Weight: | 142.58 | |
| InChI: | InChI=1/C7H7ClO/c1-5-4-6(8)2-3-7(5)9/h2-4,9H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2669/3437 | |
| Density: | 1.228 g/cm3 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Alpha: | 22 º (C=8,6N HCL) | |
| Water Solubility: | <0.1 g/100 mL at 15 ºC | |
| Solubility: | <0.1 g/100 mL at 15 ºC in water | |
| Appearance: | Off white crystals | |
| Specification: | Off-white to slightly brownish crystalline solid Safety Statements:26-36/37/39-45-61-28 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) | |
| Report: |
Reported in EPA TSCA Inventory. Chlorophenol compounds are on the Community Right-To-Know List. | |
| Packinggroup: | II | |
| Storage Temperature: | 0-6°C | |
| Color: | white to brown | |
| Usage: | Chemical intermediate, eg, for mecoprop, mcpa & mcpb herbicides, chemical intermediate for its sodium salt. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
C:Corrosive
N:Dangerousfortheenvironment
|
|
 |
||
