| Identification | |
| Name: | Ethanol,2-[(acetyloxy)methoxy]-, 1-acetate |
| Synonyms: | Ethanol,2-(hydroxymethoxy)-, diacetate (6CI);Ethanol, 2-[(acetyloxy)methoxy]-, acetate(9CI);(2-Acetoxyethoxy)methyl acetate;1,4-Diacetoxy-2-oxabutane;2-Acetoxyethyl acetoxymethyl ether;2-Oxa-1,4-butanediol diacetate; |
| CAS: | 59278-00-1 |
| EINECS: | 261-686-7 |
| Molecular Formula: | C7H12O5 |
| Molecular Weight: | 176.17 |
| InChI: | InChI=1/C7H12O5/c1-6(8)11-4-3-10-5-12-7(2)9/h3-5H2,1-2H3 |
| Molecular Structure: | ![(C7H12O5) Ethanol,2-(hydroxymethoxy)-, diacetate (6CI);Ethanol, 2-[(acetyloxy)methoxy]-, acetate(9CI);(2-Aceto...](https://img.guidechem.com/casimg/59278-00-1.gif) |
| Properties | |
| Density: | 1.119 g/cm3 |
| Stability: | Below 40C |
| Refractive index: | 1.419 |
| Appearance: | clear, colourless or yellowish liquid |
| Specification: | Bright Yellow Liquid usageEng:Intermediate for the preparation of Acyclovir-d4 |
| Usage: | Intermediate for the preparation of Acyclovir-d4 |
| Safety Data | |
 |
|
