| Identification | |
| Name: | Trimethylamine hydrochloride |
| Synonyms: | Methanamine,N,N-dimethyl-, hydrochloride (9CI);Trimethylamine, hydrochloride (8CI);Trimethylamine hydrochloric acid;Trimethylamine monohydrochloride;Trimethylammonium chloride; |
| CAS: | 593-81-7 |
| EINECS: | 209-810-0 |
| Molecular Formula: | C3H10ClN |
| Molecular Weight: | 95.57 |
| InChI: | InChI=1/C3H9N.ClH/c1-4(2)3;/h1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.692g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | SOLUBLE |
| Solubility: | Soluble |
| Appearance: | white to slightly cream crystalline powder |
| Specification: |
Trimethylamine hydrochloride , its cas register number is 593-81-7. It also can be called Trimethylammonium chloride ; Methanamine, N,N-dimethyl-, hydrochloride .It is a white to slightly cream crystalline powder. |
| HS Code: | 29211190 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Hygroscopic |
| Color: | Colorless gas [Note: A liquid below 37 deg F. Shipped as a liquefied compressed gas]. |
| Usage: | In manufacture of quaternary ammonium compounds, as insect attractant,. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
