| Identification | |
| Name: | Trimethylamine |
| Synonyms: | Trimethylamine,water solution; TMA; aqueous solution |
| CAS: | 75-50-3 |
| EINECS: | 200-875-0 |
| Molecular Formula: | C3H9N |
| Molecular Weight: | 59.1103 |
| InChI: | InChI=1S/C3H9N/c1-4(2)3/h1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 170kgs |
| Melting Point: | -117 C |
| Flash Point: | -6.67 |
| Density: | 0.632 |
| Stability: | Stable. Incompatible with a wide variety of materials, including bases, acids, oxidizing agents, brass, zinc, magnesium, aluminium, mercury, mercury oxides, acid chlorides, acid anhydrides. Hygroscopic. Highly flammable. Readily forms explosive mixtures with air. |
| Refractive index: | n20/D 1.357 |
| Water Solubility: | Miscible |
| Solubility: | Miscible |
| Appearance: | clear liquid |
| Specification: | colourless gas Safety Statements:26-36-45-36/37/39-16-29-39-3 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 16:Keep away from sources of ignition - No smoking 29:Do not empty into drains 39:Wear eye/face protection 3:Keep in a cool place |
| Packinggroup: | II |
| Flash Point: | -6.67 |
| Color: | Colorless gas [Note: A liquid below 37 deg F. Shipped as a liquefied compressed gas]. |
| Safety Data | |
| Hazard Symbols |
3 (Packing Group : II)
|
 |
|
