| Identification | |
| Name: | L-Histidine hydrochloride monohydrate |
| Synonyms: | Histidine,monohydrochloride, monohydrate, L- (8CI);L-Histidine, monohydrochloride,monohydrate (9CI);L-Histidinemonohydrate monohydrochloride; |
| CAS: | 5934-29-2 |
| EINECS: | 211-438-9 |
| Molecular Formula: | C6H12ClN3O3 |
| Molecular Weight: | 209.63 |
| InChI: | InChI=1/C6H9N3O2.ClH.H2O/c7-5(6(10)11)1-4-2-8-3-9-4;;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H;1H2/t5-;;/m0../s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 231.3°C |
| Boiling Point: | 458.9°C at 760 mmHg |
| Density: | 1.485 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | 9.9 o (C=11, 6 N HCL) |
| Solubility: | soluble |
| Appearance: | white crystals |
| HS Code: | 29332990 |
| Flash Point: | 231.3°C |
| Storage Temperature: | Store at RT. |
| Usage: | Histamine is involved in local immune responses, regulating physiological function in the gut and as a neurotransmitter. |
| Safety Data | |
| Hazard Symbols | |
 |
|
