Identification |
Name: | L-Histidine hydrochloride monohydrate |
Synonyms: | Histidine,monohydrochloride, monohydrate, L- (8CI);L-Histidine, monohydrochloride,monohydrate (9CI);L-Histidinemonohydrate monohydrochloride; |
CAS: | 5934-29-2 |
EINECS: | 211-438-9 |
Molecular Formula: | C6H12ClN3O3 |
Molecular Weight: | 209.63 |
InChI: | InChI=1/C6H9N3O2.ClH.H2O/c7-5(6(10)11)1-4-2-8-3-9-4;;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H;1H2/t5-;;/m0../s1 |
Molecular Structure: |
|
Properties |
Transport: | 25kgs |
Flash Point: | 231.3°C |
Boiling Point: | 458.9°C at 760 mmHg |
Density: | 1.485 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Alpha: | 9.9 o (C=11, 6 N HCL) |
Solubility: | soluble |
Appearance: | white crystals |
HS Code: | 29332990 |
Flash Point: | 231.3°C |
Storage Temperature: | Store at RT. |
Usage: | Histamine is involved in local immune responses, regulating physiological function in the gut and as a neurotransmitter. |
Safety Data |
Hazard Symbols |
|
|
|