| Identification | |
| Name: | L-Cysteine hydrochloride monohydrate |
| Synonyms: | Cysteine,hydrochloride, monohydrate, L- (8CI);L-Cysteine, hydrochloride, monohydrate(9CI); |
| CAS: | 7048-04-6 |
| EINECS: | 200-157-7 |
| Molecular Formula: | C3H8ClNO2S.H2O |
| Molecular Weight: | 175.63 |
| InChI: | InChI=1/C3H7NO2S.ClH.H2O/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);1H;1H2/t2-;;/m0../s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.5 oC |
| Boiling Point: | 293.9 oC at 760 mmHg |
| Stability: | Stable. Incompatible with strong oxidizing agents, most common metals, hydrogen chloride. |
| Water Solubility: | H2O: 1 M at 20 ºC, clear, colorless |
| Solubility: | H2O: 1 M at 20 oC, clear, colorless |
| Appearance: | white crystalline powder |
| Specification: | white crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29309013 |
| Flash Point: | 131.5 oC |
| Storage Temperature: | Store at RT. |
| Sensitive: | Hygroscopic |
| Color: | Colorless crystals White crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
