| Identification | |
| Name: | DL-Lactic acid |
| Synonyms: | DL-2-Hydroxypropanoic acid;alpha-Hydroxypropionic acid; |
| CAS: | 598-82-3 |
| EINECS: | 209-954-4 |
| Molecular Formula: | C3H6O3 |
| Molecular Weight: | 90.08 |
| InChI: | InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.276 g/cm3 |
| Refractive index: | n20/D 1.4262 |
| Solubility: | Miscible with alcohol, glycerol, and furfural Soluble in alcohol and furfurol; slightly soluble in ether; insoluble in chloroform, petroleum ether, carbon disulfide. Miscible in alcohol-ether solution. In water, miscible |
| Specification: |
DL-lactic acid , with CAS number of 598-82-3, can be called 2-hydroxy-Propanoic acid ; (+/-)-Lactic acid ; 2-Hydroxypropanoic acid ; 2-Hydroxypropansäure ; 2-hydroxy-propionic acid . DL-lactic acid (CAS NO.598-82-3) is widely used in food, medicine, electroplating industry. |
| HS Code: | 29181100 |
| Storage Temperature: | 2-8°C |
| Color: | Crystals Yellow to colorless crystals or syrupy 50% liquid |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
