| Identification | |
| Name: | L(+)-Lactic acid |
| Synonyms: | (S)-(+)-2-Hydroxypropanoic acid; L(+)-Lactic acid solution; L-Lactic acid, free acid; lactate standard 40 mg/dl; L(+)lactic acid free acid sigmaultra; L-Lactic acid; (S)-2-Hydroxypropionic acid |
| CAS: | 79-33-4 |
| EINECS: | 201-196-2 |
| Molecular Formula: | C3H6O3 |
| Molecular Weight: | 90.08 |
| InChI: | InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3261 |
| Melting Point: | 52-54 oC |
| Flash Point: | 109.9 oC |
| Density: | 1.206 |
| Refractive index: | 1.426-1.428 |
| Alpha: | -13.5 o (C=2.5, 1.5N NAOH) |
| Water Solubility: | SOLUBLE |
| Solubility: | 10 mg/mL, clear, colorless in water |
| Appearance: | crystalline solid |
| Specification: |
?L-(+)-Lactic acid (CAS NO.79-33-4) is also named as (S)-(+)-Lactic acid ; (S)-2-Hydroxypropanoic acid ; (S)-2-Hydroxypropionic acid ; (S)-2-Hydroxypropionsaeure ; (S)-Lactic acid ; (S)-Milchsaeure ; 4-03-00-00633 (Beilstein Handbook Reference) ; Acidum sarcolacticum ; BRN 1720251 ; Espiritin ; Fleischmilchsaeure ; L( )-2-Hydroxypropionsaeure ; L-(+)-alpha-Hydroxypropionic acid ; L-Lactic acid ; PH 90 ; PURAC ; Paralactic acid ; Paramilchsaeure ; Sarcolactic acid ; Tisulac ; UNII-F9S9FFU82N?.?L(+)-Lactic acid (CAS NO.79-33-4) is crystalline solid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 109.9 oC |
| Sensitive: | Hygroscopic |
| Color: | Crystals Yellow to colorless crystals or syrupy 50% liquid |
| Usage: | Occurs in small quantities in the blood and muscle fluid of man and animals. The lactic acid concentration increases in muscle and blood after vigorous activity. L-(+)-Lactic acid is also present in liver, kidney, thymus gland, human amniotic fluid, |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
