| Identification | |
| Name: | Gabapentin hydrochloride |
| Synonyms: | 1-(Aminomethyl)cyclohexaneacetic acid;Cyclohexaneacetic acid, 1-(aminomethyl)-;Gabapentino [Spanish];Neurontin (TN);Go 3450;CI 945;Cyclohexaneacetic acid,1-(aminomethyl)-;Gabapentine;2-[1-(aminomethyl)cyclohexyl]acetic acid;GOE 2450;2-[1-(azaniumylmethyl)cyclohexyl]acetate;Gabapentin;Gabapentino [INN-Spanish];Gabapentine [INN-French];Garbapentin;Gabapetine; |
| CAS: | 60142-96-3 |
| EINECS: | 262-076-3 |
| Molecular Formula: | C9H17NO2 |
| Molecular Weight: | 207.7 |
| InChI: | InChI=1/C9H17NO2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-7,10H2,(H,11,12) |
| Molecular Structure: | ![(C9H17NO2) 1-(Aminomethyl)cyclohexaneacetic acid;Cyclohexaneacetic acid, 1-(aminomethyl)-;Gabapentino [Spanish]...](https://img.guidechem.com/casimg/60142-96-3.gif) |
| Properties | |
| Transport: | Not reg |
| Density: | 1.058 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.484 |
| Water Solubility: | H2O: 10 mg/mL |
| Solubility: | H2O:10mg/mL |
| Appearance: | white to off-white crystalline powder |
| Specification: |
? Gabapentin (CAS NO.60142-96-3), its Synonyms are 1-(Aminomethyl)cyclohexaneacetic acid ; Aclonium ; Cyclohexaneacetic acid, 1-(aminomethyl)- ; Gabapentine ; Gabapentino ; Gabapentinum . |
| Biological Activity: | Anticonvulsant with several possible mechanisms of action. Increases GABA in the brain and binds to a novel site associated with voltage-sensitive Ca 2+ channels. Prevents neuronal death and is antinociceptive and anxiolytic. |
| Storage Temperature: | Keep tightly closed. |
| Color: | off-white |
| Usage: | Amino acid structurally related to -Aminobutyric Acid (GABA), designed to cross the blood brain barrier. Used as an anticonvulsant |
| Safety Data | |
 |
|
