| Identification | |
| Name: | 3-nitrophthalic acid |
| Synonyms: | 3-Nitro-1,2-benzenedicarboxylic acid; 3-NPA |
| CAS: | 603-11-2 |
| EINECS: | 210-030-8 |
| Molecular Formula: | C8H5NO6 |
| Molecular Weight: | 211.13 |
| InChI: | InChI=1/C8H5NO6/c10-7(11)4-2-1-3-5(9(14)15)6(4)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.671 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Appearance: | slightly yellow crystalline powder |
| Specification: |
3-Nitrophthalic acid (CAS NO.603-11-2) is also named as AI3-02074 ; NSC 3120 ; 1,2-Benzenedicarboxylic acid, 3-nitro- ; Phthalic acid, 3-nitro- (8CI) . 3-Nitrophthalic acid (CAS NO.603-11-2) is pale yellow crystals. It is soluble in water, methanol, ethanol, slightly soluble in ether, insoluble in chloroform, carbon tetrachloride, carbon disulfide, benzene. 3-Nitrophthalic acid is stable and incompatible with strong oxidizing agents. |
| HS Code: | 29173980 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
