| Identification | |
| Name: | 3-Nitrophthalic anhydride |
| Synonyms: | 1,3-Isobenzofurandione, 4-nitro-;Phthalic anhydride, 3-nitro-;4-Nitro-isobenzofuran-1,3-dione;Phthalic anhydride, 3-nitro- (8CI);4-nitroisobenzofuran-1,3-dione; |
| CAS: | 641-70-3 |
| EINECS: | 211-373-6 |
| Molecular Formula: | C8H3NO5 |
| Molecular Weight: | 193.11 |
| InChI: | InChI=1/C8H3NO5/c10-7-4-2-1-3-5(9(12)13)6(4)8(11)14-7/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.687 g/cm3 |
| Stability: | No data. |
| Water Solubility: | MAY DECOMPOSE |
| Solubility: | may decompose with water |
| Appearance: | beige to yellow crystalline powder |
| Specification: |
3-Nitrophthalic anhydride (CAS NO.641-70-3) is also named as AI3-03720 ; NSC 27006 ; NSC 4134 ; 1,3-Isobenzofurandione, 4-nitro- ; Phthalic anhydride, 3-nitro- (8CI) . 3-Nitrophthalic anhydride (CAS NO.641-70-3) is beige to yellow crystalline powder. It is soluble in acetone, hot alcohol and hot acetic acid, slightly soluble in benzene, insoluble in water. |
| HS Code: | 29173980 |
| Storage Temperature: | Store at RT. |
| Sensitive: | Moisture Sensitive |
| Usage: | An intermediate for the synthesis of a benzimidazole PARP inhibitor I (succinate salt) (ABT-472) |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
