| Identification |
| Name: | 2,6-Dichloroaniline |
| Synonyms: | 2,6-dichlorobenzenamine; |
| CAS: | 608-31-1 |
| EINECS: | 210-160-5 |
| Molecular Formula: | C6H5Cl2N |
| Molecular Weight: | 162.02 |
| InChI: | InChI=1/C6H5Cl2N/c7-4-2-1-3-5(8)6(4)9/h1-3H,9H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3442 |
| Density: | 1 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | insoluble |
| Appearance: | white crystals |
| Packinggroup: | II |
| HS Code: | 29214210 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a cool place in the original container and protect from sunlight. Store in a tightly closed container. Store in a dry area. Do not exceed 25-30C. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
