| Identification | |
| Name: | 3,5-Dichloroaniline |
| Synonyms: | - |
| CAS: | 626-43-7 |
| EINECS: | 210-948-9 |
| Molecular Formula: | C6H5Cl2N |
| Molecular Weight: | 162.02 |
| InChI: | InChI=1/C6H5Cl2N/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3442 |
| Density: | 1.58 |
| Stability: | Stable under normal shipping and handling conditions. Substance may undergo color change upon exposure to light and air. |
| Refractive index: | 1.613 |
| Solubility: | Insoluble |
| Appearance: | white crystals |
| Specification: |
?3,5-Dichloroaniline (CAS NO.626-43-7)? is also called Aniline, 3,5-dichloro- ; Benzenamine, 3,5-dichloro- ; CCRIS 2396 .?3,5-Dichloroaniline (CAS NO.626-43-7) is soluble in alcohol, ether, diethyl carbonate, insoluble in water.?It?is highly toxic corrosive. |
| Packinggroup: | II |
| HS Code: | 29214210 |
| Color: | dark gray |
| Usage: | Chemical intermed for vinclozolin fungicide (eg, for grapes) & iprodione fungicide (eg, for use on turf), chemical intermed for organic synthesis. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
