| Identification | |
| Name: | L-Xylose |
| Synonyms: | Xylose, L-(8CI);NSC 26213;L(+)-Xylose; |
| CAS: | 609-06-3 |
| EINECS: | 210-174-1 |
| Molecular Formula: | C5H10O5 |
| Molecular Weight: | 150.1299 |
| InChI: | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.508 g/cm3 |
| Refractive index: | -20 ° (C=10, H2O) |
| Water Solubility: | H2O: 0.1 g/mL, clear, colorless |
| Solubility: | H2O: 0.1 g/mL, clear, colorless |
| Appearance: | fine crystalline powder |
| Specification: | WHITE FINE CRYSTALLINE POWDER Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29400000 |
| Safety Data | |
 |
|
