| Identification | |
| Name: | Phenol,3,4,5-trichloro- |
| Synonyms: | 3,4,5-Trichlorophenol;NSC 243667 |
| CAS: | 609-19-8 |
| EINECS: | 210-183-0 |
| Molecular Formula: | C6H3 Cl3 O |
| Molecular Weight: | 197.44 |
| InChI: | InChI=1/C6H3Cl3O/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Melting Point: | 101 deg C |
| Flash Point: | 123.9°C |
| Boiling Point: | 281.3°C at 760 mmHg |
| Density: | 1.596g/cm3 |
| Stability: | Stable. Probably combustible. Incompatible with strong oxidizing agents, acid chlorides, acid anhydrides. |
| Refractive index: | 1.608 |
| Solubility: | Sol in ether; slightly sol in water |
| Specification: | off-white crystalline solid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 123.9°C |
| Storage Temperature: | 0-6°C |
| Color: | Needles from ligroin |
| Safety Data | |
| Hazard Symbols | |
 |
|
