| Identification | |
| Name: | L-Leucine |
| Synonyms: | L(+)-Leucine;.alpha.-Aminoisocaproic acid;2-Amino-4-methylpentanoic acid, (S)-;L-Norvaline, 4-methyl-;L-alpha-Aminoisocaproic acid;Leucine (USP);2-Amino-4-methylvaleric acid (L);(2S)-alpha-Leucine;Pentanoic acid, 2-amino-4-methyl-, (S)-;(S)-2-Amino-4-methyl-pentanoic acid;Leucine, L-;2-Amino-4-methylpentanoic acid;(S)-(+)-leucine;Pentanoic acid, 2-amino-4-methyl-;Leu;Valeric acid, 2-amino-4-methyl-, (S)-;(2S)-2-azaniumyl-4-methyl-pentanoate;(S)-2-Amino-4-methylvaleric acid;(2S)-2-amino-4-methylpentanoic acid;Norvaline, 4-methyl-;L-Leuzin;L-2-Amino-4-methylpentanoic acid;(2S)-alpha-2-Amino-4-methylvaleric acid;FEMA No. 3297;2-Amino-4-methylpentanoic acid (L);(S)-leucine; |
| CAS: | 61-90-5 |
| EINECS: | 200-522-0 |
| Molecular Formula: | C6H13NO2 |
| Molecular Weight: | 131.17 |
| InChI: | InChI=1/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.035 g/cm3 |
| Stability: | Stability Moisture and light sensitive. Incompatible with strong oxidising agents. |
| Alpha: | 15.4 o (C=4, 6N HCL) |
| Water Solubility: | 22.4 g/L (20 C) |
| Solubility: | 1 M HCl: 50 mg/mL |
| Appearance: | White crystalline powder |
| Specification: | White crystalline powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29224995 |
| Storage Temperature: | Store at RT. |
| Color: | White glistening hexagonal plates from aqueous alcohol White crystals |
| Safety Data | |
 |
|
