| Identification | |
| Name: | Acetic acid,lithiumsalt,dihydrate (8CI,9CI) |
| Synonyms: | Lithiumacetate dihydrate;Acetic acid lithium salt dihydrate; |
| CAS: | 6108-17-4 |
| EINECS: | 208-914-3 |
| Molecular Formula: | C2H4O2.2H2O.Li |
| Molecular Weight: | 102.01 |
| InChI: | InChI=1/C2H4O2.Li.2H2O/c1-2(3)4;;;/h1H3,(H,3,4);;2*1H2/q;+1;;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 40°C |
| Boiling Point: | 117.1°C at 760 mmHg |
| Density: | 1.3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | White rhombohedral crystals |
| Specification: |
Lithium acetate dihydrate (6108-17-4) is white crystalline powder with stench - acetic odor. It is also called for Acetic acid lithium salt dihydrate . It is incompatible with strong oxidizing agents. It decompounds to yield carbon monoxide, carbon dioxide, oxides of Lithium . Lithium acetate dihydrate (6108-17-4) can be used to separate saturated fatty acids from unsaturated fatty acids. In pharmaceutical industry, it is used for the preparation of diuretics. In addition, it is used as Lithium-ion battery material. |
| Flash Point: | 40°C |
| Storage Temperature: | −20°C |
| Usage: | Buffer for gel electrophoresis of dna and rna. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
