| Identification |
| Name: | Alpha,Alpha'-Dichloro-o-xylene |
| Synonyms: | 1,2-Bis(chloromethyl)benzene; alpha,alpha-Dichloro-o-xylene; o-Xylylene dichloride; DICHLORO(ALPHA, ALPHA'-)-O-XYLENE; A,A'-DICHLORO-O-XYLENE; A,A-DICHLORO-O-XYLENE; 1,2-DI(CHLOROMETHYL)BENZENE; O-XYLYLENE CHLORIDE |
| CAS: | 612-12-4 |
| EINECS: | 210-291-8 |
| Molecular Formula: | C8H8Cl2 |
| Molecular Weight: | 175.06 |
| InChI: | InChI=1/C8H8Cl2/c9-5-7-3-1-2-4-8(7)6-10/h1-4H,5-6H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3261 |
| Density: | 1.393 g/cm3 (0 C) |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | hydrolysis |
| Solubility: | hydrolysis |
| Appearance: | White crystals crystals. |
| Packinggroup: | II |
| HS Code: | 29036990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | white to light beige |
| Safety Data |
| Hazard Symbols |
C:Corrosive
Xi:Irritant
|
| |
 |
