| Identification |
| Name: | Alpha,Alpha'-Dibromo-p-xylene |
| Synonyms: | p-Xylylene dibromide; Alpha; 1,4-Bis(bromomethyl)benzene; alpha,alpha-Dibromo-p-xylene; alpha,alpha[-Dibromo-p-xylene; Benzene, 1,4-bis(bromomethyl)- |
| CAS: | 623-24-5 |
| EINECS: | 210-781-1 |
| Molecular Formula: | C8H8Br2 |
| Molecular Weight: | 263.96 |
| InChI: | InChI=1/C8H8Br2/c9-5-7-1-2-8(6-10)4-3-7/h1-4H,5-6H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3448 |
| Density: | 2.012 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.614 |
| Water Solubility: | soluble, hydrolyses |
| Solubility: | soluble, hydrolyses |
| Appearance: | white to light yellow crystal powder |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Sensitive: | Lachrymatory |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
