| Identification | |
| Name: | 2,4-Dimethoxybenzaldehyde |
| Synonyms: | Benzaldehyde, 2,4-dimethoxy-; |
| CAS: | 613-45-6 |
| EINECS: | 210-342-4 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.17 |
| InChI: | InChI=1/C9H10O3/c1-11-8-4-3-7(6-10)9(5-8)12-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 16510 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.534 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | white solid |
| Specification: |
?2,4-Dimethoxybenzaldehyde (CAS NO.613-45-6) is also named as AI3-21269?;?NSC 27023 ; Benzaldehyde, 2,4-dimethoxy- .?2,4-Dimethoxybenzaldehyde (CAS NO.613-45-6) is white solid. |
| HS Code: | 29124900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Usage: | A component of hair dyes |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
