| Identification | |
| Name: | 3,5-Dimethoxybenzaldehyde |
| Synonyms: | Benzaldehyde, 3,5-dimethoxy-; |
| CAS: | 7311-34-4 |
| EINECS: | 230-772-6 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C9H10O3/c1-11-8-3-7(6-10)4-9(5-8)12-2/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 119 oC |
| Density: | 1.114 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | ? |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | white to beige crystalline solid |
| Specification: |
?3,5-Dimethoxybenzaldehyde (CAS NO.7311-34-4) is also named as Benzaldehyde, 3,5-dimiethoxy ; 3,5-Dimethoxybenzaldehyde 98% .?3,5-Dimethoxybenzaldehyde (CAS NO.7311-34-4) is white to beige crystalline solid. |
| Flash Point: | 119 oC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
