| Identification | |
| Name: | Benzenemethanol, a-ethyl-, (aS)- |
| Synonyms: | Benzenemethanol,a-ethyl-, (S)-; Benzyl alcohol, a-ethyl-, (S)-(-)- (8CI);(-)-1-Phenylpropan-1-ol; (-)-1-Phenylpropanol; (-)-1-Phenylpropyl alcohol; (-)-a-Ethylbenzyl alcohol; (-)-a-Phenylpropanol;(1S)-1-Phenyl-1-propanol; (S)-(-)-1-Phenyl-1-propanol; (S)-1-Phenylpropan-1-ol;(S)-1-Phenylpropanol; (S)-Phenylethylcarbinol; (S)-a-Ethylbenzenemethanol; (S)-a-Ethylbenzyl alcohol; (S)-a-Hydroxypropylbenzene; (aS)-a-Ethylbenzenemethanol |
| CAS: | 613-87-6 |
| Molecular Formula: | C9H12 O |
| Molecular Weight: | 136.191 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 6 |
| Flash Point: | 97.3 ºC |
| Boiling Point: | 219 ºC at 760 mmHg |
| Density: | 218 |
| Refractive index: | n20/D 1.520(lit.) |
| Water Solubility: | at 25 deg C (mg/L): 5677 |
| Solubility: | at 25 deg C (mg/L): 5677 |
| Specification: |
(S)-(-)-1-Phenyl-1-propanol (613-87-6) is chiral chemical with appearance of clear colorless liquid. It is also known as (S)-(-)-alpha-Ethylbenzyl alcohol ; (S)-alpha-Ethylbenzyl alcohol ; (S)-(-)-1-Phenyl-1-propanol ; (S)-1-Phenylpropan-1-ol ; (S)-1-Phenyl-propanol ; (S)-(-)-1-Phenyl-1-propanol, 99% (99% ee /glc) ; S-(-)-1-Phenyl-1-propanol 99+% ; (S)-(-)-1-Phenyl-1-propanol, 98% ee, 95% . |
| Flash Point: | 97.3 ºC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
