| Identification |
| Name: | Benzenemethanol,a-ethyl- |
| Synonyms: | Benzylalcohol, a-ethyl- (8CI);(RS)-1-Phenylpropan-1-ol;(RS)-1-Phenylpropanol;1-Hydroxy-1-phenylpropane;1-Phenyl-1-hydroxypropane;1-Phenyl-n-propanol;1-Propanol, 1-phenyl-;Bilergon;Carbicol;Ejibil;Epatoxfen;Felicur;Felitrope;Fepar;Livonal;NSC 41708;Phenicol;Phenycholon;Phenylchol;SH 261;a-Ethylbenzenemethanol;a-Hydroxypropylbenzene; |
| CAS: | 93-54-9 |
| EINECS: | 202-256-0 |
| Molecular Formula: | C9H12O |
| Molecular Weight: | 136.19 |
| InChI: | InChI=1/C9H12O/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Density: | 0.994 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.519-1.521 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | clear, colorless clear liquid |
| HS Code: | 29062900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Used as a heat transfer medium. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
