| Identification | |
| Name: | DL-Malic acid |
| Synonyms: | MALIC ACID, (DL);Butanedioic acid, hydroxy-, (.+-.)-;Malic acid, DL-;hydroxysuccinic acid;FDA 2018;2-Hydroxybutanedioic acid;H2mal;Malate;apple acid;(2S)-2-hydroxybutanedioate;(2R)-2-hydroxybutanedioate;Malic acid;.+-.-Malic acid;hydroxybutanedioic acid;dl-Hydroxybutanedioic acid;Aepfelsaeure;DL- MALIC ACID;L-Hydroxysuccinic Acid;DL-MALIC ACID 99-100.5% FCC (IV); |
| CAS: | 617-48-1 |
| EINECS: | 210-514-9 |
| Molecular Formula: | C4H6O5 |
| Molecular Weight: | 134.09 |
| InChI: | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 130-132 oC |
| Flash Point: | 153.4 oC |
| Boiling Point: | 306.4 oC at 760 mmHg |
| Density: | 1.641 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases, amines, alkali metals, carbonates. |
| Solubility: | methanol: 0.1 g/mL, clear, colorless |
| Appearance: | white crystalline powder |
| Flash Point: | 153.4 oC |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | COLORLESS WHITE TRICLINIC CRYSTALS |
| Usage: | The active ingredient in many sour or tart foods. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
