| Identification | |
| Name: | N,N-Diethylformamide |
| Synonyms: | N,N-Diethylformylamide |
| CAS: | 617-84-5 |
| EINECS: | 210-533-2 |
| Molecular Formula: | C5H11NO |
| Molecular Weight: | 101.15 |
| InChI: | InChI=1/C5H11NO/c1-3-6(4-2)5-7/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Melting Point: | 176-177°C |
| Density: | 0.908 |
| Refractive index: | 1.434 |
| Solubility: | miscible with ethanol, acetone and benzene. Soluble in alcohol and ether |
| Appearance: | clear colorless to pale yellow liquid |
| Specification: |
Diethyl formamide ,its CAS NO. is 617-84-5,the synonyms is Diethylamid kyseliny mravenci ; Diethylamidkyselinymravenci ; Formamide, n,n-diethyl- ; n,n-Diethyl-formamid ; n-Formyldiethylamine ; Formyldiethylamine ; Formic acid diethylamide . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
