| Identification |
| Name: | Hexanoic acid, propylester |
| Synonyms: | 1-Propyln-caproate;NSC 53784;Propyl caproate; |
| CAS: | 626-77-7 |
| EINECS: | 210-963-0 |
| Molecular Formula: | C9H18O2 |
| Molecular Weight: | 158.24 |
| InChI: | InChI=1/C9H18O2/c1-3-5-6-7-9(10)11-8-4-2/h3-8H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3272 |
| Flash Point: | 125? |
| Density: | 0.867 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.412 |
| Solubility: | Insoluble |
| Appearance: | Colorless to pale yellow liquid with pineapple odor |
| Packinggroup: | III |
| Flash Point: | 125? |
| Storage Temperature: | 2-8°C |
| Safety Data |
| |
 |
