Identification |
Name: | Hexanoic acid, propylester |
Synonyms: | 1-Propyln-caproate;NSC 53784;Propyl caproate; |
CAS: | 626-77-7 |
EINECS: | 210-963-0 |
Molecular Formula: | C9H18O2 |
Molecular Weight: | 158.24 |
InChI: | InChI=1/C9H18O2/c1-3-5-6-7-9(10)11-8-4-2/h3-8H2,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 3272 |
Flash Point: | 125? |
Density: | 0.867 |
Stability: | Stable at normal temperatures and pressures. |
Refractive index: | 1.412 |
Solubility: | Insoluble |
Appearance: | Colorless to pale yellow liquid with pineapple odor |
Packinggroup: | III |
Flash Point: | 125? |
Storage Temperature: | 2-8°C |
Safety Data |
|
|