| Identification | |
| Name: | Octanoic acid, propylester |
| Synonyms: | NSC 23736;Propyl caprylate; Propyl octanoate |
| CAS: | 624-13-5 |
| EINECS: | 210-830-7 |
| Molecular Formula: | C11H22 O2 |
| Molecular Weight: | 186.29 |
| InChI: | InChI=1/C11H22O2/c1-3-5-6-7-8-9-11(12)13-10-4-2/h3-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.872 g/cm3 |
| Refractive index: | 1.426 |
| Appearance: | COLOURLESS LIQUID |
| Specification: |
Propyl octanoate (624-13-5) also can be called Propyl caprylate and Octanoic acid, propyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
