| Identification | |
| Name: | 3,4-Dichlorobenzaldehyde |
| Synonyms: | 3,4-dichlorobenzenecarboxaldehyde |
| CAS: | 6287-38-3 |
| EINECS: | 228-520-5 |
| Molecular Formula: | C7H4Cl2O |
| Molecular Weight: | 175.01 |
| InChI: | InChI=1/C7H4Cl2O/c8-6-2-1-5(4-10)3-7(6)9/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1759 |
| Density: | 1.4 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.6 |
| Water Solubility: | INSOLUBLE |
| Solubility: | insoluble in water |
| Appearance: | light yellow crystal |
| Specification: |
Removal in wastewater treatment of 3,4-Dichlorobenzaldehyde (6287-38-3) can be stated as follows: |
| Packinggroup: | III |
| Storage Temperature: | 0-6°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
Xi:Irritant
|
 |
|
