| Identification |
| Name: | 2,6-Dichlorobenzaldehyde |
| Synonyms: | o,o'-dichlorobenzaldehyde |
| CAS: | 83-38-5 |
| EINECS: | 201-472-2 |
| Molecular Formula: | C7H4Cl2O |
| Molecular Weight: | 175.01 |
| InChI: | InChI=1/C7H4Cl2O/c8-6-2-1-3-7(9)5(6)4-10/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3261 |
| Flash Point: | 97.4 oC |
| Density: | 1.4 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. Air, light and moisture sensitive. |
| Refractive index: | 1.577? |
| Water Solubility: | Insoluble AUTOIGNITION |
| Solubility: | Insoluble AUTOIGNITION |
| Appearance: | White to Yellowish Crystalline Powder |
| Packinggroup: | III |
| HS Code: | 29130000 |
| Flash Point: | 97.4 oC |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
