| Identification | |
| Name: | 4-Aminoveratrole |
| Synonyms: | 3,4-Dimethoxyaniline; 4-aminoveratrol |
| CAS: | 6315-89-5 |
| EINECS: | 228-647-6 |
| Molecular Formula: | C8H11NO2 |
| Molecular Weight: | 153.18 |
| InChI: | InChI=1/C8H11NO2/c1-10-7-4-3-6(9)5-8(7)11-2/h3-5H,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | > 110 C |
| Density: | 174 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.54 |
| Water Solubility: | insoluble |
| Solubility: | Soluble AUTOIGNITION |
| Appearance: | off-white to gray powder |
| Specification: |
Removal in wastewater treatment of 3,4-dimethoxyaniline (6315-89-5) can be stated as follows: |
| Packinggroup: | III |
| HS Code: | 29222900 |
| Flash Point: | > 110 C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
