| Identification |
| Name: | Urea,N,N,N',N'-tetramethyl- |
| Synonyms: | Urea,1,1,3,3-tetramethyl- (6CI);Urea, tetramethyl- (8CI,9CI);NSC 91488;TMU;Temur;Tetramethylcarbamide; |
| CAS: | 632-22-4 |
| EINECS: | 211-173-9 |
| Molecular Formula: | C5H12N2O |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.9879 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4496-1.4516 |
| Water Solubility: | miscible |
| Solubility: | miscible |
| Appearance: | clear, colorless liquid |
| HS Code: | 29241900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Color: | LIQUID |
| Usage: | 1) As intermediates in pesticides.
2) As a high-grade solvent, in dyestuff and other industries.
3) As intermediates in surfactant.
4) In peptides and other products produced by the bio-chemical industry. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
