| Identification | |
| Name: | Chlorinated paraffin |
| Synonyms: | Cereclor 70;Chlorcosane;Paraffin waxes and Hydrocarbon waxes, chloro;A 70;ADK Cizer E 410;ADK Cizer E 450;Adekacizer E 470;Aquamix108;Arubren;Arubren CP;CP 42;Cereclor 45;Cereclor 50LV;Cereclor 51L;Cereclor 52;Cereclor 54;Cereclor65L;Cereclor 70L;Cereclor S 63;Cereclor S 70;Chlorez 700;Chlorez 700SSNP;Chlorez 760;Chlorinated paraffin waxes;Chloroflo 42;Chloroparaffin waxes;Chlorowax;Chlorowax 170;Chlorowax 40-40;Chlorowax 50;Chlorowax 500C;Chlorowax 60-50;Chlorowax 70L;Chlorowax LV;Chlorowax S 70;Cloparin S 70;Diablo 700X;Empara L 50;Hordaresin CH 171F;Hordaresin NP 70;Paroil 140;Paroil 145;Paroil170HV;Unichlor;Unichlor 50;Unichlor 70AX; |
| CAS: | 63449-39-8 |
| EINECS: | 264-150-0 |
| Molecular Formula: | C23H41Cl7 |
| Molecular Weight: | 348.95204 |
| InChI: | InChI=1S/C10H16Cl6/c1-3-6(12)4-7(13)9(15)10(16)8(14)5(2)11/h5-10H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 |
| Density: | 1.153 g/cm3 |
| Stability: | Stable. |
| Refractive index: | n20/D 1.525 |
| Water Solubility: | tetrahydrofuran: 0.1 g/mL, clear |
| Solubility: | tetrahydrofuran: 0.1 g/mL, clear |
| Appearance: | Clear, colorless liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Keep tightly closed in a cool place in a tightly closed container. |
| Color: | Generally they are viscous liquids. Light yellow to amber, thick, oily liquid. Colorless to pale yellow liquids |
| Usage: | As solvent for dichloramine-t, dissolving about 8%. |
| Safety Data | |
 |
|
