| Identification |
| Name: | Chlorinated Paraffin |
| Synonyms: | Chlorinated Paraffin (70%); Chlorinated Paraffin 52%; Chlorinated Paraffin 60%; Chlorinated Paraffin (40%); Alkanes, C22-40, chloro |
| CAS: | 63449-39-8;106232-86-4 |
| EINECS: | 264-150-0 |
| Molecular Formula: | C24H44Cl6 |
| Molecular Weight: | 565.7479 |
| InChI: | InChI=1/C24H44Cl6/c1-3-7-19(25)9-5-11-21(27)13-15-23(29)17-18-24(30)16-14-22(28)12-6-10-20(26)8-4-2/h19-24H,3-18H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.101g/cm3 |
| Refractive index: | 1.485 |
| Appearance: | Pale yellow viscous liquid |
| Color: | Generally they are viscous liquids. Light yellow to amber, thick, oily liquid. Colorless to pale yellow liquids |
| Safety Data |
| |
 |