| Identification | |
| Name: | Phosphine,cyclohexyldiphenyl- |
| Synonyms: | Cyclohexyldiphenylphosphine;Diphenylcyclohexylphosphine |
| CAS: | 6372-42-5 |
| EINECS: | 228-904-2 |
| Molecular Formula: | C18H21 P |
| Molecular Weight: | 268.34 |
| InChI: | InChI=1/C18H21P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | Insoluble in water |
| Appearance: | white to light yellow crystal powder |
| Specification: |
Cyclohexyldiphenylphosphine (CAS NO.6372-42-5), its Synonyms are Diphenylcyclohexylphosphine ; Phosphine, cyclohexyldiphenyl- ; Cyclohexyldiphenyl-phosphin ; Cyclohexyl diphenyl phosphine . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air Sensitive |
| Usage: | Reagent for c-c bond formation. |
| Safety Data | |
 |
|
