Identification |
Name: | Cyclohexanol, phenyl-,triester with boric acid (H3BO3) (9CI) |
Synonyms: | Triphenylcyclohexyl borate;Boric acid, tris(phenylcyclohexyl) ester;AC1MILKD;tris(1-phenylcyclohexyl) borate;LS-45057;63732-31-0 |
CAS: | 63732-31-0 |
Molecular Formula: | C36H45 B O3 |
Molecular Weight: | 536.62 |
InChI: | InChI=1/C36H45BO3/c1-7-19-31(20-8-1)34(25-13-4-14-26-34)38-37(39-35(27-15-5-16-28-35)32-21-9-2-10-22-32)40-36(29-17-6-18-30-36)33-23-11-3-12-24-33/h1-3,7-12,19-24H,4-6,13-18,25-30H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 237.6°C |
Boiling Point: | 610.4°Cat760mmHg |
Density: | 1.1g/cm3 |
Refractive index: | 1.581 |
Specification: |
Triphenylcyclohexyl borate , its cas register number is 63732-31-0. It also can be called Boric acid, tris(phenylcyclohexyl) ester .
|
Flash Point: | 237.6°C |
Safety Data |
|
|