| Identification |
| Name: | Valeryl chloride |
| Synonyms: | Valeroyl chloride; Pentanoyl chloride; n-Valeryl chloride |
| CAS: | 638-29-9 |
| EINECS: | 211-330-1 |
| Molecular Formula: | C5H9ClO |
| Molecular Weight: | 120.58 |
| InChI: | InChI=1/C5H9ClO/c1-2-3-4-5(6)7/h2-4H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2502 |
| Melting Point: | -90 C
|
| Density: | 1.01 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.419-1.421 |
| Water Solubility: | decomposes |
| Solubility: | Decomposes |
| Appearance: | Clear to slightly yellow liquid |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
