| Identification | |
| Name: | Mercury, [m-(2-amino-5-nitro-1,3-phenylene)]dihydroxydi-(9CI) |
| Synonyms: | Benzenamine,4-nitro-, mercury complex |
| CAS: | 63951-09-7 |
| Molecular Formula: | C6H6 Hg2 N2 O4 |
| Molecular Weight: | 571.32 |
| InChI: | InChI=1/C6H4N2O2.2Hg.2H2O/c7-5-1-3-6(4-2-5)8(9)10;;;;/h3-4H,7H2;;;2*1H2/rC6H4Hg2N2O2.2H2O/c7-4-1-3(10(11)12)2-5(8)6(4)9;;/h1-2H,9H2;2*1H2 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
2,6-Bis(hydroxymercuri)-4-nitroaniline ,its cas register number is 63951-09-7. It also can be called Aniline, 2,6-bis(hydroxymercuri)-4-nitro- . |
| Report: |
Mercury and its compounds are on the Community Right-To-Know List. |
| Safety Data | |
 |
|
