| Identification | |
| Name: | Mercury, dichloro[m-[2-[[(phenylmethoxy)carbonyl]amino]-4,5-thiazolediyl]]di-(9CI) |
| Synonyms: | Carbamicacid, 2-thiazolyl-, phenylmethyl ester, mercury complex; NSC 74648 |
| CAS: | 64050-46-0 |
| Molecular Formula: | C11H8 Cl2 Hg2 N2 O2 S |
| Molecular Weight: | 704.35 |
| InChI: | InChI=1/C11H8N2O2S.2ClH.2Hg/c14-11(13-10-12-6-7-16-10)15-8-9-4-2-1-3-5-9;;;;/h2,4-7H,8H2,(H,12,13,14);2*1H;;/q;;;2*+1/p-2/rC11H8Cl2Hg2N2O2S/c12-14-8-2-1-7(5-9(8)15-13)6-19-11(18)17-10-16-3-4-20-10/h1-5H,6H2,(H,16,17,18) |
| Molecular Structure: |  |
| Properties | |
| Specification: |
4,5-Dichloropyrocatechol ,its CAS number is 64050-46-0,it can be called Mercury, dichloro(mu-(2-((phenylmethoxy)carbonyl)amino)-4,5-thiazolediyl)di- ; 2-Thiazolecarbamic acid, 4,5-bis(chloromercuri)-, benzyl ester . |
| Report: |
Mercury and its compounds are on The Community Right-To-Know List. |
| Safety Data | |
 |
|
