| Identification | |
| Name: | o-Anisidine antimonyl tartrate |
| Synonyms: | o-Anisidine antimonyl tartrate;Antimonate(2-), bis(mu-(2,3-dihydroxybutanedioato(4-)-O1,O2:O3,O4))di-, stereoisomer, dihydrogen, compd. with 2-methoxybenzenamine (1:2);Benzenamine, 2-methoxy-, stereoisomer of bis(mu-(2,3-dihydroxybutanedioato(4-)-O1,O2:O3,O4))diantimonate(2-) (2:1);LS-20119;64070-14-0 |
| CAS: | 64070-14-0 |
| Molecular Formula: | C15H21NO13Sb2 |
| Molecular Weight: | 666.8461 |
| InChI: | InChI=1/C7H9NO.2C4H6O6.2Sb/c1-9-7-5-3-2-4-6(7)8;2*5-1(3(7)8)2(6)4(9)10;;/h2-5H,8H2,1H3;2*1-2,5-6H,(H,7,8)(H,9,10);; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 209.4°C |
| Boiling Point: | 399.3°C at 760 mmHg |
| Report: |
Antimony and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 209.4°C |
| Safety Data | |
 |
|
