| Identification | |
| Name: | o-Anisidine |
| Synonyms: | 2-Methoxyaniline; Ortho-Anisidine; o-Aminoanisole; 2-Aminoanisole; 2-(2-methylphenoxy)-benzenamin; 2-(o-tolyloxy)-anilin; aminomethyldiphenylether; 2-Aminophenyl-2-crysylether |
| CAS: | 90-04-0 |
| EINECS: | 201-963-1 |
| Molecular Formula: | C7H9NO |
| Molecular Weight: | 123.15 |
| InChI: | InChI=1/C7H9NO/c1-9-7-5-3-2-4-6(7)8/h2-5H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2431 |
| Density: | 1.092 |
| Stability: | Stable. Incompatible with strong oxidizing agents, acid anhydrides, chloroformates, acids, some plastics, rubber. Air sensitive. |
| Refractive index: | 1.573-1.575 |
| Solubility: | Insoluble |
| Appearance: | yellowish liquid turns brownish on exposure to air |
| Specification: | reddish or brown liquid Safety Statements:53-45 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| HS Code: | 29222200 |
| Storage Temperature: | Refrigerator |
| Sensitive: | Light Sensitive |
| Color: | PALE YELLOWISH LIQUID Reddish or yellowish colored oil Colorless to pink liquid Red to yellow, oily liquid [Note: A solid below 41 degrees F]. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
