| Identification | |
| Name: | PHENTOLAMINE MESYLATE |
| Synonyms: | VASOMAX; m-(n-(2-imidazolin-2-ylmethyl)-p-toluidino)-; phenomonomethanesulfonate(sal; phentolaminemethanesulphonate; phentolamine methanesulfonate; Phentolamine methanesulfonate salt; phentolamine mesilate |
| CAS: | 65-28-1 |
| EINECS: | 200-604-6 |
| Molecular Formula: | C17H19N3O?CH4O3S;C18H23 |
| Molecular Weight: | 377.46 |
| InChI: | InChI=1/C17H19N3O.CH4O3S/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15;1-5(2,3)4/h2-8,11,21H,9-10,12H2,1H3,(H,18,19);1H3,(H,2,3,4) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Flash Point: | 287°C |
| Boiling Point: | 551°C at 760 mmHg |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | 50 mg/mL |
| Solubility: | 50 mg/mL |
| Appearance: | White to pale buff powder. Odorless. Hygroscopic. A complex combination of polypeptides produced by the metabolic processes of Bacillus subtilis and licheniformis. |
| Packinggroup: | III |
| Flash Point: | 287°C |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Refrigerator (approx 4 C). Store protected from moisture. |
| Color: | white to off-white |
| Usage: | An adrenergic blocking agent. An antihypertensive. Used for the treatment of pheochromocytoma. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
