| Identification | |
| Name: | Phenol, 2,3-dinitro- |
| Synonyms: | 2,3-DNP;2,3-Dinitrophenol; NSC 156083 |
| CAS: | 66-56-8 |
| EINECS: | 200-628-7 |
| Molecular Formula: | C6H4 N2 O5 |
| Molecular Weight: | 184.12 |
| InChI: | InChI=1/C6H4N2O5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1320 |
| Density: | 1.65 g/cm3 |
| Specification: |
2,3-Dinitrophenol ,its cas register number is 66-56-8. It also can be called Phenol, 2,3-dinitro- ; and 6,5-Dinitrophenol . |
| Packinggroup: | I |
| Safety Data | |
| Hazard Symbols |
T: Toxic
N: Dangerous for the environment
|
 |
|
