| Identification | |
| Name: | Phenol,3-(1-methylpropyl)-, 1-(N-methylcarbamate) |
| Synonyms: | Carbamicacid, methyl-, m-sec-butylphenyl ester (7CI,8CI); Phenol, 3-(1-methylpropyl)-,methylcarbamate (9CI); Chevron 5305; Chevron RE 5305; Ortho 5305; RE 5305;m-(1-Methylpropyl)phenyl methylcarbamate; m-sec-Butylphenyl methylcarbamate |
| CAS: | 673-19-8 |
| Molecular Formula: | C12H17 N O2 |
| Molecular Weight: | 207.30 |
| InChI: | InChI=1/C12H17NO2/c1-4-9(2)10-6-5-7-11(8-10)15-12(14)13-3/h5-9H,4H2,1-3H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 122.4°C |
| Boiling Point: | 278.8°C at 760 mmHg |
| Density: | 1.023g/cm3 |
| Refractive index: | 1.504 |
| Specification: |
m-sec-Butylphenyl N-methylcarbamate (CAS NO.673-19-8) is also named as 3-(1-Methylpropyl)phenol methylcarbamate ; 3-sec-Butylphenyl N-methylcarbamate ; AI3-27039 ; BRN 2214027 ; California chemical company RE5305 ; Chevron 5305 ; Chevron RE5305 ; ENT 27,039 ; H-28 ; Ortho 5305 ; Phenol, m-sec-butyl-, methylcarbamate ; RE 5305 ; RE 5305 (California chemical) ; m-(1-Methylpropyl)phenylmethylcarbamate . m-sec-Butylphenyl N-methylcarbamate (CAS NO.673-19-8) is highly toxic. It will produce toxic nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. Keep m-sec-Butylphenyl N-methylcarbamate (CAS NO.673-19-8) separate from raw materials of food. |
| Flash Point: | 122.4°C |
| Safety Data | |
 |
|
