| Identification | |
| Name: | Acetic acid,2-(3-methylbutoxy)-, 2-propen-1-yl ester |
| Synonyms: | Aceticacid, (3-methylbutoxy)-, 2-propenyl ester (9CI);Allyl isoamyl glycolate; |
| CAS: | 67634-00-8 |
| EINECS: | 266-803-5 |
| Molecular Formula: | C10H18O3 |
| Molecular Weight: | 186.25 |
| InChI: | InChI=1/C10H18O3/c1-4-6-13-10(11)8-12-7-5-9(2)3/h4,9H,1,5-8H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -23 |
| Flash Point: | 205? |
| Density: | 0.937 |
| Stability: | No data. |
| Refractive index: | 1.4317 |
| Solubility: | Insoluble in water |
| Appearance: | Clear colorless liquid. |
| Specification: |
? Allyl (3-methylbutoxy)acetate , its CAS NO. is 67634-00-8, the synonyms are EINECS 266-803-5 ; Glycolic acid 2-pentyloxy allyl ester ; Isoamyloxyacetic acid, allyl ester ; Acetic acid, (3-methylbutoxy)-, 2-propenyl ester ; Acetic acid, 2-(3-methylbutoxy)-, 2-propen-1-yl ester . |
| Flash Point: | 205? |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
