| Identification | |
| Name: | Acetic acid,2-(cyclohexyloxy)-, 2-propen-1-yl ester |
| Synonyms: | Aceticacid, (cyclohexyloxy)-, 2-propenyl ester (9CI);Allyl 2-(cyclohexyloxy)acetate;Cyclogalbanate;Cyclogalbaniff;Isoananat; |
| CAS: | 68901-15-5 |
| EINECS: | 272-657-3 |
| Molecular Formula: | C11H18O3 |
| Molecular Weight: | 198.26 |
| InChI: | InChI=1/C11H18O3/c1-2-8-13-11(12)9-14-10-6-4-3-5-7-10/h2,10H,1,3-9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >100 oC |
| Boiling Point: | 283 oC |
| Density: | 1.016 |
| Refractive index: | 1.460-1.464 |
| Appearance: | colorless transparent liquid |
| Specification: |
? Allyl cyclohexyloxyacetate , its CAS NO. is 68901-15-5, the synonyms are EINECS 272-657-3 ; Acetic acid, (cyclohexyloxy)-, 2-propenyl ester ; Acetic acid, 2-(cyclohexyloxy)-, 2-propen-1-yl ester ; Allyl (cyclohexyloxy)acetate . |
| Flash Point: | >100 oC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
