| Identification |
| Name: | dibutyl hydrogen phosphite, compound with methyl-1H-benzotriazole (1:1) |
| Synonyms: | Phosphorous acid, dibutyl ester, compd. with 6(or 7)-methyl-1H-benzotriazole (1:1);Dibutyl hydrogen phosphonate, tolyltriazole salt;Dibutyl hydrogen phosphite, compound with methyl-1H-benzotriazole (1:1);Phosphorous acid, dibutyl ester, compd. with methyl-1H-benzotriazole (1:1);dibutyl hydrogen phosphite - 5-methyl-2H-benzotriazole (1:1) |
| CAS: | 67845-60-7 |
| EINECS: | 267-332-8 |
| Molecular Formula: | C15H26N3O3P |
| Molecular Weight: | 327.359 |
| InChI: | InChI=1/C8H19O3P.C7H7N3/c1-3-5-7-10-12(9)11-8-6-4-2;1-5-2-3-6-7(4-5)9-10-8-6/h9H,3-8H2,1-2H3;2-4H,1H3,(H,8,9,10) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 122.6°C |
| Boiling Point: | 279°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 122.6°C |
| Safety Data |
| |
 |
