| Identification | |
| Name: | 1-(o-tolyl)biguanide, compound with 5-methyl-1H-benzotriazole (1:1) |
| Synonyms: | Imidodicarbonimidic diamide, N-(2-methylphenyl)-, compd. with 6-methyl-1H-benzotriazole (1:1);1-(o-Tolyl)biguanide, compound with 5-methyl-1H-benzotriazole (1:1);Imidodicarbonimidic diamide, N-(2-methylphenyl)-, compd. with 5-methyl-1H-benzotriazole (1:1);1-(diaminomethylidene)-2-(2-methylphenyl)guanidine - 5-methyl-2H-benzotriazole (1:1) |
| CAS: | 68480-32-0 |
| EINECS: | 270-910-2 |
| Molecular Formula: | C16H20N8 |
| Molecular Weight: | 324.3836 |
| InChI: | InChI=1/C9H13N5.C7H7N3/c1-6-4-2-3-5-7(6)13-9(12)14-8(10)11;1-5-2-3-6-7(4-5)9-10-8-6/h2-5H,1H3,(H6,10,11,12,13,14);2-4H,1H3,(H,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 202.6°C |
| Boiling Point: | 411.3°C at 760 mmHg |
| Flash Point: | 202.6°C |
| Safety Data | |
 |
|
